ChemNet > CAS > 57601-89-5 methyl 2-[(cyanomethyl)thio]benzoate
57601-89-5 methyl 2-[(cyanomethyl)thio]benzoate
상품명칭 |
methyl 2-[(cyanomethyl)thio]benzoate |
별명 |
methyl 2-[(cyanomethyl)sulfanyl]benzoate |
분자식 |
C10H9NO2S |
분자량 |
207.249 |
InChI |
InChI=1/C10H9NO2S/c1-13-10(12)8-4-2-3-5-9(8)14-7-6-11/h2-5H,7H2,1H3 |
cas번호 |
57601-89-5 |
분자 구조 |
|
밀도 |
1.24g/cm3 |
녹는 점 |
121℃ |
비등점 |
338.6°C at 760 mmHg |
굴절 지수 |
1.574 |
인화점 |
158.6°C |
위험성 표시 |
Xn:Harmful;
|
리스크 규칙 |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
보안 규칙 |
S36/37:Wear suitable protective clothing and gloves.;
|
|